methyl 2-(o-nitrobenzylidene)-acetoacetate structure
|
Common Name | methyl 2-(o-nitrobenzylidene)-acetoacetate | ||
|---|---|---|---|---|
| CAS Number | 39562-27-1 | Molecular Weight | 249.21900 | |
| Density | 1.296g/cm3 | Boiling Point | 395.9ºC at 760mmHg | |
| Molecular Formula | C12H11NO5 | Melting Point | 100-101 ºC (ethanol ) | |
| MSDS | N/A | Flash Point | 177.2ºC | |
| Name | methyl 2-(o-nitrobenzylidene)-acetoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 395.9ºC at 760mmHg |
| Melting Point | 100-101 ºC (ethanol ) |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.21900 |
| Flash Point | 177.2ºC |
| Exact Mass | 249.06400 |
| PSA | 89.19000 |
| LogP | 2.26340 |
| Index of Refraction | 1.583 |
| InChIKey | APKKCRAKPMSAEI-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=Cc1ccccc1[N+](=O)[O-])C(C)=O |
| Storage condition | 2-8°C |
| Water Solubility | Very slightly soluble (0.5 g/L) (25 ºC) |
| Hazard Codes | Xi,N |
|---|---|
| HS Code | 2918300090 |
|
~87%
methyl 2-(o-nit... CAS#:39562-27-1 |
| Literature: Adachi; Yamamori; Hiramatsu; Sakai; Sato; Kawakami; Uno; Ueda Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 8 p. 3235 - 3252 |
|
~95%
methyl 2-(o-nit... CAS#:39562-27-1 |
| Literature: Bayer Aktiengesellschaft Patent: US4600778 A1, 1986 ; |
|
~0%
methyl 2-(o-nit... CAS#:39562-27-1 |
| Literature: David, J. Y.; Hurvois, J. P.; Tallec, A.; Toupet, L. Tetrahedron, 1995 , vol. 51, # 11 p. 3181 - 3196 |
|
~0%
methyl 2-(o-nit... CAS#:39562-27-1 |
| Literature: Goerlitzer; Trittmacher; Jones Pharmazie, 2002 , vol. 57, # 8 p. 523 - 529 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-NITROBENZYLIDENEMETHYLESTER |
| 2-Nitrobenzylidenmethylester |
| 2-Nitrobenzylidenacetessigsaeuremethylester |
| Methyl 2-(2'-nitrobenzylidene)acetoacetate |
| Nifedipine Impurity 4 |