2,2',4,4',6-Pentachlorobiphenyl structure
|
Common Name | 2,2',4,4',6-Pentachlorobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 39485-83-1 | Molecular Weight | 326.43300 | |
| Density | 1.522g/cm3 | Boiling Point | 354.1ºC at 760mmHg | |
| Molecular Formula | C12H5Cl5 | Melting Point | 95.86°C (estimate) | |
| MSDS | N/A | Flash Point | 165.4ºC | |
| Name | 2,2',4,4',6-Pentachlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.522g/cm3 |
|---|---|
| Boiling Point | 354.1ºC at 760mmHg |
| Melting Point | 95.86°C (estimate) |
| Molecular Formula | C12H5Cl5 |
| Molecular Weight | 326.43300 |
| Flash Point | 165.4ºC |
| Exact Mass | 323.88300 |
| LogP | 6.62060 |
| Index of Refraction | 1.619 |
| InChIKey | RKUAZJIXKHPFRK-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-c2c(Cl)cc(Cl)cc2Cl)c(Cl)c1 |
| HS Code | 2903999090 |
|---|
|
~%
2,2',4,4',6-Pen... CAS#:39485-83-1 |
| Literature: Bolgar; et al. Chemosphere, 1995 , vol. 31, # 2 p. 2687 - 2705 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,3,5-trichloro-2-(2,4-dichlorophenyl)benzene |