2,2',4,4',6,6'-hexanitro[1,1'-biphenyl]-3,3'-diol
Modify Date: 2025-09-07 12:21:23
![2,2',4,4',6,6'-hexanitro[1,1'-biphenyl]-3,3'-diol Structure](https://image.chemsrc.com/caspic/011/14184-98-6.png)
2,2',4,4',6,6'-hexanitro[1,1'-biphenyl]-3,3'-diol structure
|
Common Name | 2,2',4,4',6,6'-hexanitro[1,1'-biphenyl]-3,3'-diol | ||
|---|---|---|---|---|
| CAS Number | 14184-98-6 | Molecular Weight | 456.19200 | |
| Density | 2.049g/cm3 | Boiling Point | 508.2ºC at 760 mmHg | |
| Molecular Formula | C12H4N6O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.5ºC | |
| Name | 3-(3-hydroxy-2,4,6-trinitrophenyl)-2,4,6-trinitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 2.049g/cm3 |
|---|---|
| Boiling Point | 508.2ºC at 760 mmHg |
| Molecular Formula | C12H4N6O14 |
| Molecular Weight | 456.19200 |
| Flash Point | 204.5ºC |
| Exact Mass | 455.97900 |
| PSA | 315.38000 |
| LogP | 5.35320 |
| Vapour Pressure | 5.95E-11mmHg at 25°C |
| Index of Refraction | 1.785 |
| InChIKey | ZGEXBICQPGHLKE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(-c2c([N+](=O)[O-])cc([N+](=O)[O-])c(O)c2[N+](=O)[O-])c([N+](=O)[O-])c1O |
| HS Code | 2907299090 |
|---|
|
~%
2,2',4,4',6,6'-... CAS#:14184-98-6 |
| Literature: Dacons,J.C. et al. Tetrahedron, 1963 , vol. 19, p. 791 - 799 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 2,2',4,4',6,6'-Hexanitro(1,1'-biphenyl)-3,3'-diol |
| 2.4.6.2'.4'.6'-Hexanitro-3.3'-dihydroxy-biphenyl |
| EINECS 238-037-1 |
| 2,2',4,4',6,6'-hexanitrobiphenyl-3,3'-diol |
| 2,4,6,2',4',6'-Hexanitro-biphenyl-3,3'-diol |
| 3,3'-dihydroxy-2,2',4,4',6,6'-hexanitrobiphenyl |
| 2.4.6.2'.4'.6'-Hexanitro-3.3'-dioxy-diphenyl |
| Diprikrinsaeure |