2,2',4,4',6,6'-hexanitroazobenzene structure
|
Common Name | 2,2',4,4',6,6'-hexanitroazobenzene | ||
|---|---|---|---|---|
| CAS Number | 19159-68-3 | Molecular Weight | 452.20700 | |
| Density | 2.15g/cm3 | Boiling Point | 699.5ºC at 760mmHg | |
| Molecular Formula | C12H4N8O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 376.9ºC | |
| Name | bis(2,4,6-trinitrophenyl)diazene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.15g/cm3 |
|---|---|
| Boiling Point | 699.5ºC at 760mmHg |
| Molecular Formula | C12H4N8O12 |
| Molecular Weight | 452.20700 |
| Flash Point | 376.9ºC |
| Exact Mass | 451.99500 |
| PSA | 299.64000 |
| LogP | 6.69040 |
| Vapour Pressure | 1.3E-18mmHg at 25°C |
| Index of Refraction | 1.836 |
| InChIKey | PSDIVOYKWCKHLG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(N=Nc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| RIDADR | UN 0473 |
|---|---|
| Hazard Class | 1.1A |
| HS Code | 2927000090 |
|
~2%
2,2',4,4',6,6'-... CAS#:19159-68-3 |
| Literature: Abdallah, A. Abdallah Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1981 , vol. 20, # 11 p. 994 - 995 |
|
~%
2,2',4,4',6,6'-... CAS#:19159-68-3 |
| Literature: Leemann; Grandmougin Chemische Berichte, 1908 , vol. 41, p. 1305 |
|
~%
2,2',4,4',6,6'-... CAS#:19159-68-3 |
| Literature: Leemann; Grandmougin Chemische Berichte, 1908 , vol. 41, p. 1305 |
|
~%
2,2',4,4',6,6'-... CAS#:19159-68-3 |
| Literature: Grandmougin; Leemann Chemische Berichte, 1906 , vol. 39, p. 4384 |
|
~%
2,2',4,4',6,6'-... CAS#:19159-68-3 |
| Literature: Grandmougin; Leemann Chemische Berichte, 1906 , vol. 39, p. 4384 |
|
~%
2,2',4,4',6,6'-... CAS#:19159-68-3 |
| Literature: Leemann; Grandmougin Chemische Berichte, 1908 , vol. 41, p. 1305 |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 242-850-7 |
| 2,2',4,4',6,6'-Hexanitroazobenzene |
| Hexanitroazoxy benzene [Forbidden] |
| 2,2',4,4',6,6'-Hexanitrobenzol |
| dipicryl-diazene |
| 2.2',4.4',6.6'-Hexanitro-azobenzol |
| Diazene,bis(2,4,6-trinitrophenyl) |
| Hexanitroazoxy benzene |
| 2.4.6.2'.4'.6'-Hexanitro-azobenzol |