Acetamide,N-[4-nitro-3-(trifluoromethyl)phenyl]- structure
|
Common Name | Acetamide,N-[4-nitro-3-(trifluoromethyl)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 393-12-4 | Molecular Weight | 248.15900 | |
| Density | 1.478 g/cm3 | Boiling Point | 389.8ºC at 760 mmHg | |
| Molecular Formula | C9H7F3N2O3 | Melting Point | 108 °C | |
| MSDS | N/A | Flash Point | 189.5ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 4'-nitro-3'-(trifluoromethyl)acetanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.478 g/cm3 |
|---|---|
| Boiling Point | 389.8ºC at 760 mmHg |
| Melting Point | 108 °C |
| Molecular Formula | C9H7F3N2O3 |
| Molecular Weight | 248.15900 |
| Flash Point | 189.5ºC |
| Exact Mass | 248.04100 |
| PSA | 74.92000 |
| LogP | 3.16820 |
| InChIKey | MIHJCLQINRFOLX-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P260-P280-P303 + P361 + P353-P304 + P340 + P310-P305 + P351 + P338 |
| Hazard Codes | Xi,Xn |
| Risk Phrases | R22 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | 1325 |
| HS Code | 2924299090 |
|
~%
Acetamide,N-[4-... CAS#:393-12-4 |
| Literature: Schering Corporation Patent: US4302599 A1, 1981 ; |
|
~%
Acetamide,N-[4-... CAS#:393-12-4 |
| Literature: Jones Journal of the American Chemical Society, 1947 , vol. 69, p. 2352 |
|
~%
Acetamide,N-[4-... CAS#:393-12-4
Detail
|
| Literature: I.G.Farbenind. Patent: DE637318 , 1935 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 23, p. 190 Full Text Show Details I.G.Farbenind. Patent: DE693610 , 1937 ; |
|
~%
Acetamide,N-[4-... CAS#:393-12-4
Detail
|
| Literature: De Brouwer Bulletin des Societes Chimiques Belges, 1930 , vol. 39, p. 298,306, 307 |
|
~%
Acetamide,N-[4-... CAS#:393-12-4
Detail
|
| Literature: Pouterman; Girardet Helvetica Chimica Acta, 1947 , vol. 30, p. 107,110 |
| Precursor 4 | |
|---|---|
| DownStream 7 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4'-Nitro-3'-(trifluoroMethyl)acetanilide |
| 5-ACETAMIDO-2-NITROBENZOTRIFLUORIDE |
| N-[4-nitro-3-(trifluoromethyl)phenyl]acetamide |
| N-(4-Nitro-3-(trifluoromethyl)phenyl)acetamide |
| MFCD00017994 |