CK548
Modify Date: 2025-08-21 16:43:46
CK548 structure
|
Common Name | CK548 | ||
|---|---|---|---|---|
| CAS Number | 388604-55-5 | Molecular Weight | 384.67500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11BrClNO2S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | 2-(3-bromophenyl)-3-(5-chloro-2-hydroxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H11BrClNO2S |
|---|---|
| Molecular Weight | 384.67500 |
| Exact Mass | 382.93800 |
| PSA | 65.84000 |
| LogP | 4.65170 |
| InChIKey | KEGQNJITMFBVAC-UHFFFAOYSA-N |
| SMILES | O=C1CSC(c2cccc(Br)c2)N1c1cc(Cl)ccc1O |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H400 |
| Precautionary Statements | P273 |
| RIDADR | UN 3077 9 / PGIII |
|
Tumor Suppressor NF2 Blocks Cellular Migration by Inhibiting Ectodomain Cleavage of CD44.
Mol. Cancer Res. 13 , 879-90, (2015) Ectodomain cleavage (shedding) of transmembrane proteins by metalloproteases (MMP) generates numerous essential signaling molecules, but its regulation is not totally understood. CD44, a cleaved trans... |
| CK-548 |
| 2-(3-Bromophenyl)-3-(5-chloro-2-hydroxyphenyl)-4-thiazolidinone CK-0993548 |
| 2-(3-Bromophenyl)-3-(5-chloro-2-hydroxyphenyl)-4-thiazolidinone |