4-(Trifluoromethyl)-1H-indole-2,3-dione
Modify Date: 2025-09-12 17:37:00
4-(Trifluoromethyl)-1H-indole-2,3-dione structure
|
Common Name | 4-(Trifluoromethyl)-1H-indole-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 386-73-2 | Molecular Weight | 215.129 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H4F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(Trifluoromethyl)-1H-indole-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C9H4F3NO2 |
| Molecular Weight | 215.129 |
| Exact Mass | 215.019409 |
| PSA | 46.17000 |
| LogP | 1.13 |
| Index of Refraction | 1.513 |
| InChIKey | RHIANQJNIOBETN-UHFFFAOYSA-N |
| SMILES | O=C1Nc2cccc(C(F)(F)F)c2C1=O |
| HS Code | 2933990090 |
|---|
|
~%
4-(Trifluoromet... CAS#:386-73-2 |
| Literature: Sumitomo Pharmaceuticals Co., Ltd. Patent: US6576656 B1, 2003 ; |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:314-46-5
CAS#:41704-95-4| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole-2,3-dione, 4-(trifluoromethyl)- |
| 4-trifluoromethylisatin |
| 4-trifluoromethyl-1H-indole-2,3-dione |
| 4-(trifluoromethyl)indoline-2,3-dione |
| 4-trifluoromethyl-indole-2,3-dione |
| 4-trifluoromethyl-1H-indol-2,3-dione |
| 4-(Trifluoromethyl)-1H-indole-2,3-dione |
| 4-Trifluormethyl-indolin-2,3-dion |
| 4-trifluormethylisatine |