α-Copaene
Modify Date: 2025-08-23 17:51:32
α-Copaene structure
|
Common Name | α-Copaene | ||
|---|---|---|---|---|
| CAS Number | 3856-25-5 | Molecular Weight | 204.35100 | |
| Density | 0.939g/cm3 | Boiling Point | 248.5ºC at 760mmHg | |
| Molecular Formula | C15H24 | Melting Point | 74°C (lit.) | |
| MSDS | N/A | Flash Point | 105.1ºC | |
Use of α-Copaeneα-Copaene, a sesquiterpene hydrocarbon, is a fruit volatile. α-Copaene can be used as an oviposition promoter of Bactrocera oleae[1]. |
| Name | α-copaene |
|---|---|
| Synonym | More Synonyms |
| Description | α-Copaene, a sesquiterpene hydrocarbon, is a fruit volatile. α-Copaene can be used as an oviposition promoter of Bactrocera oleae[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.939g/cm3 |
|---|---|
| Boiling Point | 248.5ºC at 760mmHg |
| Melting Point | 74°C (lit.) |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35100 |
| Flash Point | 105.1ºC |
| Exact Mass | 204.18800 |
| LogP | 4.27090 |
| Index of Refraction | n20/D 1.490 |
| InChIKey | VLXDPFLIRFYIME-MFEYBKIZSA-N |
| SMILES | CC1=CCC2C3C(C(C)C)CCC2(C)C13 |
| Hazard Codes | Xn |
|---|---|
| WGK Germany | 3 |
| Copaen |
| MFCD00077631 |
| EINECS 223-364-4 |
| alpha-copaene |
| Ylangene |
| Copaene |
| (-)-α-COPAENE |
| Aglaiene |