Oxotremorine M iodide
Modify Date: 2025-10-18 17:46:18
Oxotremorine M iodide structure
|
Common Name | Oxotremorine M iodide | ||
|---|---|---|---|---|
| CAS Number | 3854-04-4 | Molecular Weight | 322.18600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H19IN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Oxotremorine M iodideOxotremorine M iodide is a potent and selective muscarinic acetylcholine receptor (mAChR) agonist. Oxotremorine M iodide potentiates NMDA receptors by muscarinic receptor dependent and independent mechanisms[1]. |
| Name | trimethyl-[4-(2-oxopyrrolidin-1-yl)but-3-ynyl]azanium,iodide |
|---|
| Description | Oxotremorine M iodide is a potent and selective muscarinic acetylcholine receptor (mAChR) agonist. Oxotremorine M iodide potentiates NMDA receptors by muscarinic receptor dependent and independent mechanisms[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C11H19IN2O |
|---|---|
| Molecular Weight | 322.18600 |
| Exact Mass | 322.05400 |
| PSA | 20.31000 |
| InChIKey | VVLMSCJCXMBGDI-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CC#CCN1CCCC1=O.[I-] |