Pefcalcitol structure
|
Common Name | Pefcalcitol | ||
|---|---|---|---|---|
| CAS Number | 381212-03-9 | Molecular Weight | 519.544 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 614.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C26H34F5NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 325.1±31.5 °C | |
Use of PefcalcitolPefcalcitol is a new antipsoriatic antedrug candidates having 16-en-22-oxa-vitamin D3 structures. |
| Name | 2-[(1S)-1-[(3aS,4E,7aS)-4-[(2Z)-2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]-N-(2,2,3,3,3-pentafluoropropyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Description | Pefcalcitol is a new antipsoriatic antedrug candidates having 16-en-22-oxa-vitamin D3 structures. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 614.0±55.0 °C at 760 mmHg |
| Molecular Formula | C26H34F5NO4 |
| Molecular Weight | 519.544 |
| Flash Point | 325.1±31.5 °C |
| Exact Mass | 519.240784 |
| PSA | 82.28000 |
| LogP | 5.42 |
| Vapour Pressure | 0.0±4.0 mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | SVCSMAZYWOQCBW-NVJMFHFGSA-N |
| SMILES | C=C1C(=CC=C2CCCC3(C)C(C(C)OCC(=O)NCC(F)(F)C(F)(F)F)=CCC23)CC(O)CC1O |
| 2-{[(1S,3R,5Z,7E,9ξ,20S)-1,3-Dihydroxy-9,10-secopregna-5,7,10,16-tetraen-20-yl]oxy}-N-(2,2,3,3,3-pentafluoropropyl)acetamide |
| M5181 |
| Pefcalcitol |
| 2-(((1S,3R,5z,7E,20S)-1,3-dihydroxy-9,10-secopregna-5,7,10(19),16-tetraen-20-yl)oxy)-N-(2,2,3,3,3-pentafluoropropyl)acetamide |
| UNII-KT5224XSHW |
| Acetamide,2-((1S)-1-((3aS,7E,7as)-7-((2Z)-((3S,5R)-3,5-dihydroxy-2-methylenecyclohexylidene)ethylidene)-3a,4,5,6,7,7a-hexahydro-3a-methyl-1H-inden-3-yl)ethoxy)-N-(2,2,3,3,3-pentafluoropropyl) |
| Acetamide, 2-[(1S)-1-[(3aS,7E,7aS)-7-[(2Z)-2-[(3S,5R)-3,5-dihydroxy-2-methylenecyclohexylidene]ethylidene]-3a,4,5,6,7,7a-hexahydro-3a-methyl-1H-inden-3-yl]ethoxy]-N-(2,2,3,3,3-pentafluoropropyl)- |
| Pefcalcitol [INN] |