5,7-Difluoroquinazolin-4(3H)-one structure
|
Common Name | 5,7-Difluoroquinazolin-4(3H)-one | ||
|---|---|---|---|---|
| CAS Number | 379228-58-7 | Molecular Weight | 182.127 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 378.7±32.0 °C at 760 mmHg | |
| Molecular Formula | C8H4F2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.8±25.1 °C | |
| Name | 5,7-difluoro-1H-quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 378.7±32.0 °C at 760 mmHg |
| Molecular Formula | C8H4F2N2O |
| Molecular Weight | 182.127 |
| Flash Point | 182.8±25.1 °C |
| Exact Mass | 182.029175 |
| PSA | 45.75000 |
| LogP | 0.91 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.620 |
| InChIKey | DIQRRDUOMDYXDK-UHFFFAOYSA-N |
| SMILES | O=c1[nH]cnc2cc(F)cc(F)c12 |
| HS Code | 2933990090 |
|---|
| Precursor 5 | |
|---|---|
| DownStream 7 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,7-Difluoro-4(1H)-quinazolinone |
| 5,7-difluoroquinazolone |
| 5,7-difluoroquinazolin-4-one |
| 5,7-difluoro-3H-quinazolin-4-one |
| 5,7-DIFLUORO-3,4-DIHYDROQUINAZOLIN-4-ONE |
| 5,7-DIFLUOROQUINAZOLIN-4(3H)-ONE |
| RW3021 |
| 4(3H)-Quinazolinone, 5,7-difluoro- |