2,2,2-trifluoro-1,1-bis(4-methoxyphenyl)ethanol structure
|
Common Name | 2,2,2-trifluoro-1,1-bis(4-methoxyphenyl)ethanol | ||
|---|---|---|---|---|
| CAS Number | 379-21-5 | Molecular Weight | 312.28400 | |
| Density | 1.258g/cm3 | Boiling Point | 411ºC at 760 mmHg | |
| Molecular Formula | C16H15F3O3 | Melting Point | 76ºC | |
| MSDS | N/A | Flash Point | 185.4ºC | |
| Name | 2,2,2-trifluoro-1,1-bis(4-methoxyphenyl)ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 411ºC at 760 mmHg |
| Melting Point | 76ºC |
| Molecular Formula | C16H15F3O3 |
| Molecular Weight | 312.28400 |
| Flash Point | 185.4ºC |
| Exact Mass | 312.09700 |
| PSA | 38.69000 |
| LogP | 3.50200 |
| Index of Refraction | 1.517 |
| InChIKey | XTAWFAFZHYWMHB-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(O)(c2ccc(OC)cc2)C(F)(F)F)cc1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2909499000 |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2,2,2-Trifluor-1,1-bis-(4-methoxy-phenyl)-aethanol |
| Benzhydrol,4,4'-dimethoxy-a-(trifluoromethyl)-(6CI,8CI) |
| 2,2,2-trifluoro-1,1-bis-(4-methoxy-phenyl)-ethanol |
| 2,2,2,3',5'-PENTAFLUOROACETOPHENONE |
| Benzenemethanol,4-methoxy-a-(4-methoxyphenyl)-a-(trifluoromethyl) |