heptafluoroisopropylbenzene 98 structure
|
Common Name | heptafluoroisopropylbenzene 98 | ||
|---|---|---|---|---|
| CAS Number | 378-34-7 | Molecular Weight | 246.12500 | |
| Density | 1.383g/cm3 | Boiling Point | 127-128 | |
| Molecular Formula | C9H5F7 | Melting Point | -10ºC | |
| MSDS | N/A | Flash Point | 28.5ºC | |
| Name | heptafluoroisopropylbenzene 98 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.383g/cm3 |
|---|---|
| Boiling Point | 127-128 |
| Melting Point | -10ºC |
| Molecular Formula | C9H5F7 |
| Molecular Weight | 246.12500 |
| Flash Point | 28.5ºC |
| Exact Mass | 246.02800 |
| LogP | 3.97600 |
| Index of Refraction | 1.411 |
| InChIKey | CHPJUEBSVFTIRX-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(c1ccccc1)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2903999090 |
|
~85%
heptafluoroisop... CAS#:378-34-7 |
| Literature: Kitazume, Tomoya; Ishikawa, Nobuo Chemistry Letters, 1982 , p. 137 - 140 |
|
~%
heptafluoroisop... CAS#:378-34-7 |
| Literature: Sheppard,W.A. Journal of the American Chemical Society, 1965 , vol. 87, # 11 p. 2410 - 2420 |
|
~%
heptafluoroisop... CAS#:378-34-7 |
| Literature: Sheppard,W.A. Journal of the American Chemical Society, 1965 , vol. 87, # 11 p. 2410 - 2420 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| (Heptafluoro-2-propyl)benzene |
| <Heptafluor-isopropy>-benzol |
| 7,8,8,8,9,9,9-Heptafluorocumene |
| [1,2,2,2-Tetrafluoro-1-(trifluoromethyl)ethyl]benzene |
| (heptafluoro-1-methylethyl)benzene |
| Heptafluoroisopropylbenzene |
| Heptafluorisopropyl-benzol |