1,2-diphenyl-4-(2-phenylthioethyl)pyrazolidine-3,5-dione structure
|
Common Name | 1,2-diphenyl-4-(2-phenylthioethyl)pyrazolidine-3,5-dione | ||
|---|---|---|---|---|
| CAS Number | 3736-92-3 | Molecular Weight | 388.48200 | |
| Density | 1.32g/cm3 | Boiling Point | 538ºC at 760mmHg | |
| Molecular Formula | C23H20N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.2ºC | |
| Name | 1,2-diphenyl-4-(2-phenylsulfanylethyl)pyrazolidine-3,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 538ºC at 760mmHg |
| Molecular Formula | C23H20N2O2S |
| Molecular Weight | 388.48200 |
| Flash Point | 279.2ºC |
| Exact Mass | 388.12500 |
| PSA | 65.92000 |
| LogP | 4.91000 |
| Index of Refraction | 1.697 |
| InChIKey | PLGXGMUJUXKCDD-UHFFFAOYSA-N |
| SMILES | O=C1C(CCSc2ccccc2)C(=O)N(c2ccccc2)N1c1ccccc1 |
| HS Code | 2933990090 |
|---|
|
~92%
1,2-diphenyl-4-... CAS#:3736-92-3 |
| Literature: Scheibye,S.; El-Barbary,A.A. Tetrahedron, 1982 , vol. 38, p. 3753 |
|
~%
1,2-diphenyl-4-... CAS#:3736-92-3 |
| Literature: Geigy A.G. Patent: US2700671 , 1952 ; Full Text Show Details Lamdan; Albarracin Soc.org.Farm.Bioquim.ind., 1959 , vol. 1, p. 41,46 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,2-Diphenyl-4-(2-phenylmercapto-aethyl)-pyrazolidin-3,5-dion |
| 3,5-Pyrazolidinedione,1,2-diphenyl-4-(2-(phenylthio)ethyl) |
| EINECS 223-109-7 |
| 1,2-Diphenyl-4-phenylthioethyl-3,5-pyrazolidinedione |
| 1,2-diphenyl-4-[2-(phenylthio)ethyl]-3,5-pyrazolidinedione |
| 1,2-diphenyl-4-(2-phenylsulfanyl-ethyl)-pyrazolidine-3,5-dione |
| Sulfinpyrazone sulfide |
| 4-[2-(phenylthio)ethyl]-1,2-diphenyl-3,5-pyrazolidinedione |
| 4-(Phenylthioethyl)-1,2-diphenyl-3,5-pyrazolidine-dione |
| 1,2-Diphenyl-4-(2-phenylthioethyl)pyrazolidine-3,5-dione |