Propanedioic acid,2-[2-(phenylthio)ethyl]-, 1,3-diethyl ester structure
|
Common Name | Propanedioic acid,2-[2-(phenylthio)ethyl]-, 1,3-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1558-97-0 | Molecular Weight | 296.38200 | |
| Density | 1.14g/cm3 | Boiling Point | 399.1ºC at 760mmHg | |
| Molecular Formula | C15H20O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.3ºC | |
| Name | diethyl 2-(2-phenylsulfanylethyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 399.1ºC at 760mmHg |
| Molecular Formula | C15H20O4S |
| Molecular Weight | 296.38200 |
| Flash Point | 186.3ºC |
| Exact Mass | 296.10800 |
| PSA | 77.90000 |
| LogP | 2.91120 |
| Vapour Pressure | 1.41E-06mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | XNJMBDCTYAVRKZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CCSc1ccccc1)C(=O)OCC |
| HS Code | 2930909090 |
|---|
|
~%
Propanedioic ac... CAS#:1558-97-0 |
| Literature: Pfister,R.; Haefliger,F. Helvetica Chimica Acta, 1961 , vol. 44, p. 232 - 237 |
|
~%
Propanedioic ac... CAS#:1558-97-0 |
| Literature: Lamdan; Albarracin Soc. arg. Farm. Bioquim. ind., 1959 , vol. 1, p. 41,46 |
|
~%
Propanedioic ac... CAS#:1558-97-0 |
| Literature: Stewart,J.M.; Westberg,H.H. Journal of Organic Chemistry, 1965 , vol. 30, p. 1951 - 1955 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (2-Phenylmercapto-aethyl)-malonsaeure-diaethylester |
| Diaethyl-2-phenylthio-aethylmalonat |
| Diethyl (2-(phenylthio)ethyl)malonate |
| (2-phenylsulfanyl-ethyl)-malonic acid diethyl ester |
| EINECS 216-320-0 |