3-Cyclohexen-1-ol,4-(4-morpholinyl)-, 1-benzoate
Modify Date: 2025-09-10 22:41:00
3-Cyclohexen-1-ol,4-(4-morpholinyl)-, 1-benzoate structure
|
Common Name | 3-Cyclohexen-1-ol,4-(4-morpholinyl)-, 1-benzoate | ||
|---|---|---|---|---|
| CAS Number | 37138-56-0 | Molecular Weight | 287.35400 | |
| Density | 1.18g/cm3 | Boiling Point | 434ºC at 760 mmHg | |
| Molecular Formula | C17H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.3ºC | |
| Name | (4-morpholin-4-ylcyclohex-3-en-1-yl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 434ºC at 760 mmHg |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.35400 |
| Flash Point | 216.3ºC |
| Exact Mass | 287.15200 |
| PSA | 38.77000 |
| LogP | 2.54990 |
| Index of Refraction | 1.58 |
| InChIKey | AVTBFWVRUBHSSJ-UHFFFAOYSA-N |
| SMILES | O=C(OC1CC=C(N2CCOCC2)CC1)c1ccccc1 |
|
~%
3-Cyclohexen-1-... CAS#:37138-56-0 |
| Literature: Lack,R.E. et al. Journal of the American Chemical Society, 1968 , vol. 90, p. 7001 - 7007 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Morpholino-4-benzoxy-1-cyclohexen |
| 4-Benzoyloxy-1-morpholinocyclohexen |
| 4-benzoyloxy-1-morpholin-4-yl-cyclohexene |
| 4-Benzoyloxy-1-morpholinocyclohexene |