2-phenethylpropanedioic acid structure
|
Common Name | 2-phenethylpropanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 3709-21-5 | Molecular Weight | 208.21100 | |
| Density | 1.29g/cm3 | Boiling Point | 393.8ºC at 760 mmHg | |
| Molecular Formula | C11H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.1ºC | |
| Name | 2-(2-phenylethyl)propanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 393.8ºC at 760 mmHg |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21100 |
| Flash Point | 206.1ºC |
| Exact Mass | 208.07400 |
| PSA | 74.60000 |
| LogP | 1.40460 |
| Index of Refraction | 1.567 |
| InChIKey | IUZIGXNXWJEZLU-UHFFFAOYSA-N |
| SMILES | O=C(O)C(CCc1ccccc1)C(=O)O |
| HS Code | 2917190090 |
|---|
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-phenethylpropanedioic acid |
| Phenaethyl-malonsaeure |
| phenethyl-malonic acid |
| 2-phenethylmalonic acid |
| phenethylmalonate |