Celogentin C, TFA salt structure
|
Common Name | Celogentin C, TFA salt | ||
|---|---|---|---|---|
| CAS Number | 370089-23-9 | Molecular Weight | 1141.20000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C52H71F3N14O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Celogentin C, TFA salt |
|---|
| Molecular Formula | C52H71F3N14O12 |
|---|---|
| Molecular Weight | 1141.20000 |
| Exact Mass | 1140.53000 |
| PSA | 394.12000 |
| LogP | 3.55960 |
| InChIKey | WWTNHRWQLIZGGK-MDRKUFBVSA-N |
| SMILES | CC(C)CC1NC(=O)C(NC(=O)C2CCC(=O)N2)C(C(C)C)c2ccc3c4c([nH]c3c2)-n2cnc(c2)CC(C(=O)O)NC(=O)C(CCCN=C(N)N)NC(=O)C2CCCN2C(=O)C(C4)NC(=O)C(C(C)C)NC1=O.O=C(O)C(F)(F)F |
|
~88%
Celogentin C, T... CAS#:370089-23-9 |
| Literature: Ma, Bing; Banerjee, Biplab; Litvinov, Dmitry N.; He, Liwen; Castle, Steven L. Journal of the American Chemical Society, 2010 , vol. 132, # 3 p. 1159 - 1171 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |