A-357300
Modify Date: 2025-09-01 09:50:05
A-357300 structure
|
Common Name | A-357300 | ||
|---|---|---|---|---|
| CAS Number | 369358-07-6 | Molecular Weight | 396.33200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23Cl2N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of A-357300A-357300 is a potent, selective, reversible MetAP2 inhibitor with IC50 of 0.12 uM, does not inhibit MetAP1 or leucine aminopeptidases at 10 uM. |
| Name | N'-[(2S,3R)-3-Amino-2-hydroxy-5-(isopropylsulfanyl)pentanoyl]-3-c hlorobenzohydrazide hydrochloride (1:1) (non-preferred name) |
|---|
| Molecular Formula | C15H23Cl2N3O3S |
|---|---|
| Molecular Weight | 396.33200 |
| Exact Mass | 395.08400 |
| PSA | 136.73000 |
| LogP | 4.23830 |
| InChIKey | BYBVYIPUGPZRSX-OLZOCXBDSA-N |
| SMILES | CC(C)SCCC(N)C(O)C(=O)NNC(=O)c1cccc(Cl)c1 |