3-Methoxyphenylmagnesium bromide solution structure
|
Common Name | 3-Methoxyphenylmagnesium bromide solution | ||
|---|---|---|---|---|
| CAS Number | 36282-40-3 | Molecular Weight | 211.33900 | |
| Density | 1.013 g/mL at 25 °C | Boiling Point | 65-67 °C | |
| Molecular Formula | C7H7BrMgO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | −4 °F | |
| Name | 3-methoxyphenylmagnesium bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.013 g/mL at 25 °C |
|---|---|
| Boiling Point | 65-67 °C |
| Molecular Formula | C7H7BrMgO |
| Molecular Weight | 211.33900 |
| Flash Point | −4 °F |
| Exact Mass | 209.95300 |
| PSA | 9.23000 |
| LogP | 2.34100 |
| InChIKey | FKUUDDGRDRPAQQ-UHFFFAOYSA-M |
| SMILES | COc1c[c-]ccc1.[Br-].[Mg+2] |
| Storage condition | 2~8 ℃ |
| Hazard Codes | F: Flammable;C: Corrosive; |
|---|---|
| Risk Phrases | R11 |
| Safety Phrases | 16-26-36/37/39-45 |
| RIDADR | UN 2924 3/PG 2 |
| HS Code | 2931900090 |
|
~%
3-Methoxyphenyl... CAS#:36282-40-3 |
| Literature: US2009/28873 A1, ; Page/Page column 33 ; US 20090028873 A1 |
|
~%
3-Methoxyphenyl... CAS#:36282-40-3 |
| Literature: US4973586 A1, ; US 4973586 A |
|
~%
3-Methoxyphenyl... CAS#:36282-40-3 |
| Literature: WO2007/20046 A1, ; Page/Page column 107-108 ; WO 2007/020046 A1 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| magnesium,methoxybenzene,bromide |
| MFCD00672002 |
| 3-Methoxyphenylmagnesium bromide |