1,1'-Biphenyl, 3,3'-dimethoxy- structure
|
Common Name | 1,1'-Biphenyl, 3,3'-dimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 6161-50-8 | Molecular Weight | 214.26000 | |
| Density | 1.056g/cm3 | Boiling Point | 328ºC(lit.) | |
| Molecular Formula | C14H14O2 | Melting Point | 44-45ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Name | 1-methoxy-3-(3-methoxyphenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.056g/cm3 |
|---|---|
| Boiling Point | 328ºC(lit.) |
| Melting Point | 44-45ºC(lit.) |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26000 |
| Flash Point | >230 °F |
| Exact Mass | 214.09900 |
| PSA | 18.46000 |
| LogP | 3.37080 |
| Index of Refraction | 1.546 |
| InChIKey | UCHNVSDXSPIKRG-UHFFFAOYSA-N |
| SMILES | COc1cccc(-c2cccc(OC)c2)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| Precursor 8 | |
|---|---|
| DownStream 7 | |
| Biphenyl,3,3'-dimethoxy |
| MFCD00008391 |
| 1,1'-Biphenyl,3,3'-dimethoxy |
| 3,3'-bis(methoxy)biphenyl |
| EINECS 228-187-6 |
| Biphenyl,3'-dimethoxy |
| 3,3'-Bianisole |
| 3,3'-Dimethoxybiphenyl |
| 3,3'-Dimethoxy-1,1'-biphenyl |