D-Mannoheptulose structure
|
Common Name | D-Mannoheptulose | ||
|---|---|---|---|---|
| CAS Number | 3615-44-9 | Molecular Weight | 210.182 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 628.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C7H14O7 | Melting Point | 151-152ºC | |
| MSDS | Chinese USA | Flash Point | 347.6±28.0 °C | |
Use of D-MannoheptuloseD-Mannoheptulose is a major non-structural carbohydrate in avocado. D-mannoheptulose is a specific inhibitor of D-glucose phosphorylation. D-Mannoheptulose can block insulin release and utilization of carbohydrate in rat[1][2][3]. |
| Name | D-Mannoheptulose |
|---|---|
| Synonym | More Synonyms |
| Description | D-Mannoheptulose is a major non-structural carbohydrate in avocado. D-mannoheptulose is a specific inhibitor of D-glucose phosphorylation. D-Mannoheptulose can block insulin release and utilization of carbohydrate in rat[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 628.0±55.0 °C at 760 mmHg |
| Melting Point | 151-152ºC |
| Molecular Formula | C7H14O7 |
| Molecular Weight | 210.182 |
| Flash Point | 347.6±28.0 °C |
| Exact Mass | 210.073959 |
| PSA | 130.61000 |
| LogP | -2.47 |
| Vapour Pressure | 0.0±4.2 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | HSNZZMHEPUFJNZ-UHFFFAOYSA-N |
| SMILES | O=C(CO)C(O)C(O)C(O)C(O)CO |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 24/25 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2914400090 |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| (3S,4S,5R,6R)-1,3,4,5,6,7-Hexahydroxy-2-heptanone |
| D-manno-2-Heptulose |
| D-MANNOHEPTULOSE |
| (3S,4S,5R,6R)-1,3,4,5,6,7-Hexahydroxyheptan-2-one |
| D-manno-Heptulose |
| D-manno-Heptulose (8CI) |
| D-manno-Hept-2-ulose |
| D-manno-Ketoheptose |
| Mannoheptulose |