3-phenyl-1-[3-[4-[3-(phenylthiocarbamoylamino)propyl]piperazin-1-yl]propyl]thiourea
Modify Date: 2025-09-28 16:45:19
![3-phenyl-1-[3-[4-[3-(phenylthiocarbamoylamino)propyl]piperazin-1-yl]propyl]thiourea Structure](https://image.chemsrc.com/caspic/146/36105-81-4.png)
3-phenyl-1-[3-[4-[3-(phenylthiocarbamoylamino)propyl]piperazin-1-yl]propyl]thiourea structure
|
Common Name | 3-phenyl-1-[3-[4-[3-(phenylthiocarbamoylamino)propyl]piperazin-1-yl]propyl]thiourea | ||
|---|---|---|---|---|
| CAS Number | 36105-81-4 | Molecular Weight | 470.69700 | |
| Density | 1.222g/cm3 | Boiling Point | 606.8ºC at 760 mmHg | |
| Molecular Formula | C24H34N6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.8ºC | |
| Name | 1-phenyl-3-[3-[4-[3-(phenylcarbamothioylamino)propyl]piperazin-1-yl]propyl]thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 606.8ºC at 760 mmHg |
| Molecular Formula | C24H34N6S2 |
| Molecular Weight | 470.69700 |
| Flash Point | 320.8ºC |
| Exact Mass | 470.22900 |
| PSA | 118.78000 |
| LogP | 4.16100 |
| Index of Refraction | 1.664 |
| InChIKey | QJMGPHFZZKILHK-UHFFFAOYSA-N |
| SMILES | S=C(NCCCN1CCN(CCCNC(=S)Nc2ccccc2)CC1)Nc1ccccc1 |
|
~99%
3-phenyl-1-[3-[... CAS#:36105-81-4 |
| Literature: Paisner, Kathryn; Zakharov, Lev N.; Doxsee, Kenneth M. Crystal Growth and Design, 2010 , vol. 10, # 8 p. 3757 - 3762 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,3'-diphenyl-1,1'-(3,3'-piperazine-1,4-diyl-dipropyl)-bis-thiourea |
| N,N'-Bis-<3-(3'-Phenylthioharnstoff)-propyl>piperazin |
| (phenylamino)({3-[4-(3-{[(phenylamino)thioxomethyl]amino}propyl)piperazinyl]pr opyl}amino)methane-1-thione |