2,4-d ethanolamine salt
Modify Date: 2025-08-25 16:41:47
2,4-d ethanolamine salt structure
|
Common Name | 2,4-d ethanolamine salt | ||
|---|---|---|---|---|
| CAS Number | 3599-58-4 | Molecular Weight | 282.12100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13Cl2NO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS07, GHS08, GHS09 |
Signal Word | Danger | |
| Name | 2-(2,4-dichlorophenoxy)acetate,2-hydroxyethylazanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13Cl2NO4 |
|---|---|
| Molecular Weight | 282.12100 |
| Exact Mass | 281.02200 |
| PSA | 92.78000 |
| LogP | 2.09450 |
| InChIKey | LWEGPOVUIQAHBP-UHFFFAOYSA-N |
| SMILES | NCCO.O=C(O)COc1ccc(Cl)cc1Cl |
CHEMICAL IDENTIFICATION
|
| Symbol |
GHS05, GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H317-H318-H351-H411 |
| Precautionary Statements | P273-P280-P305 + P351 + P338 |
| Hazard Codes | Xi,N,Xn |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | UN 3077 9 / PGIII |
| RTECS | AG6880000 |
| HS Code | 2923900090 |
|
~%
2,4-d ethanolam... CAS#:3599-58-4 |
| Literature: HELENA HOLDING COMPANY Patent: US2007/184980 A1, 2007 ; Location in patent: Page/Page column 2 ; |
|
~%
2,4-d ethanolam... CAS#:3599-58-4 |
| Literature: Seth, Anubhuti; Garg, Anita; Sharma Journal of the Indian Chemical Society, 2011 , vol. 88, # 3 p. 405 - 414 |
|
~%
2,4-d ethanolam... CAS#:3599-58-4 |
| Literature: Seth, Anubhuti; Garg, Anita; Sharma Journal of the Indian Chemical Society, 2011 , vol. 88, # 3 p. 405 - 414 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 222-752-0 |
| Acetic acid,(2,4-dichlorophenoxy)-,compd. with 2-aminoethanol (1:1) |
| Caswell No. 315Q |
| ethanolamine salt of 2,4-D |
| 2,4-Dichlorophenoxyacetic acid ethanolamine salt |
| 2,4-D-(2-Hydroxyethyl)ammonium |
| Ethanol,2-amino-,(2,4-dichlorophenoxy)acetate (salt) |
| Ethanolamine 2,4-dichlorophenoxyacetate |
| (2-Hydroxyethyl)ammonium (o,p-dichlorophenoxy)acetate |