Dipropyl 1,2-(2H4)benzenedicarboxylate structure
|
Common Name | Dipropyl 1,2-(2H4)benzenedicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 358731-29-0 | Molecular Weight | 254.315 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 317.3±10.0 °C at 760 mmHg | |
| Molecular Formula | C14H14D4O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 166.3±8.5 °C | |
Use of Dipropyl 1,2-(2H4)benzenedicarboxylateDipropyl phthalate-d4 is the deuterium labeled Dipropyl phthalate[1]. |
| Name | dipropyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Dipropyl phthalate-d4 is the deuterium labeled Dipropyl phthalate[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 317.3±10.0 °C at 760 mmHg |
| Molecular Formula | C14H14D4O4 |
| Molecular Weight | 254.315 |
| Flash Point | 166.3±8.5 °C |
| Exact Mass | 254.145615 |
| PSA | 52.60000 |
| LogP | 3.76 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.503 |
| InChIKey | MQHNKCZKNAJROC-KDWZCNHSSA-N |
| SMILES | CCCOC(=O)c1ccccc1C(=O)OCCC |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| Hazard Codes | N: Dangerous for the environment; |
| Risk Phrases | 51/53 |
| Safety Phrases | 61 |
| RIDADR | UN 3082 9/PG 3 |
| HS Code | 2917330000 |
| HS Code | 2917330000 |
|---|
| Dipropyl 1,2-(H)benzenedicarboxylate |
| 1,2-Benzene-d-dicarboxylic acid, dipropyl ester |
| Di-n-propyl phthalate-d4 |
| Dipropyl phthalate-3,4,5,6-d4 |
| Dipropyl (H)benzene-1,2-dicarboxylate |