MS-PEG3-THP
Modify Date: 2025-08-25 16:39:54
MS-PEG3-THP structure
|
Common Name | MS-PEG3-THP | ||
|---|---|---|---|---|
| CAS Number | 357204-84-3 | Molecular Weight | 312.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H24O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MS-PEG3-THPMS-PEG3-THP is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | MS-PEG3-THP |
|---|
| Description | MS-PEG3-THP is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C12H24O7S |
|---|---|
| Molecular Weight | 312.38 |
| InChIKey | RFYAMGSUFSJURS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCOCCOCCOC1CCCCO1 |