17β-Estradiol sulfate-d4 sodium structure
|
Common Name | 17β-Estradiol sulfate-d4 sodium | ||
|---|---|---|---|---|
| CAS Number | 352431-50-6 | Molecular Weight | 378.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H19D4NaO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 17β-Estradiol sulfate-d4 sodium17β-Estradiol sulfate-d4 (sodium) is the deuterium labeled 17β-Estradiol sulfate 17β-Estradiol sulfate (sodium), also known as β-Estradiol 3-sulfate sodium salt, is a neuroactive steroid[1][2]. |
| Name | sodium 17beta-estradiol-2,4,16,16-d4 3-sulfate |
|---|---|
| Synonym | More Synonyms |
| Description | 17β-Estradiol sulfate-d4 (sodium) is the deuterium labeled 17β-Estradiol sulfate 17β-Estradiol sulfate (sodium), also known as β-Estradiol 3-sulfate sodium salt, is a neuroactive steroid[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C18H19D4NaO5S |
|---|---|
| Molecular Weight | 378.45 |
| Exact Mass | 378.141510 |
| PSA | 95.04000 |
| LogP | 3.82340 |
| InChIKey | LMJQCTISQYSLPF-LDBFCMRTSA-M |
| SMILES | CC12CCC3c4ccc(OS(=O)(=O)[O-])cc4CCC3C1CCC2O.[Na+] |
| Estra-1,3,5(10)-triene-2,4,16,16-d-3,17-diol, 3-(hydrogen sulfate), sodium salt, (17β)- (1:1) |
| Sodium (17β)-17-hydroxy(2,4,16,16-H)estra-1,3,5(10)-trien-3-yl sulfate |