1-(5-bromoacenaphthen-3-yl)ethanone
Modify Date: 2025-09-21 16:42:54
1-(5-bromoacenaphthen-3-yl)ethanone structure
|
Common Name | 1-(5-bromoacenaphthen-3-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 35223-32-6 | Molecular Weight | 275.14100 | |
| Density | 1.506g/cm3 | Boiling Point | 422.2ºC at 760 mmHg | |
| Molecular Formula | C14H11BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.8ºC | |
| Name | 1-(5-bromo-1,2-dihydroacenaphthylen-3-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.506g/cm3 |
|---|---|
| Boiling Point | 422.2ºC at 760 mmHg |
| Molecular Formula | C14H11BrO |
| Molecular Weight | 275.14100 |
| Flash Point | 122.8ºC |
| Exact Mass | 273.99900 |
| PSA | 17.07000 |
| LogP | 3.90350 |
| Index of Refraction | 1.684 |
| InChIKey | DLWLKJGZZLTUPZ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(Br)c2cccc3c2c1CC3 |
|
~%
1-(5-bromoacena... CAS#:35223-32-6 |
| Literature: Nightingale; Brooker Journal of the American Chemical Society, 1950 , vol. 72, p. 5539,5542 |
|
~%
1-(5-bromoacena... CAS#:35223-32-6 |
| Literature: Deady,L.W. et al. Journal of Organic Chemistry, 1972 , vol. 37, p. 3335 - 3338 |
|
~%
1-(5-bromoacena... CAS#:35223-32-6 |
| Literature: Adonin; Ryabinin; Starichenko Russian Journal of Organic Chemistry, 1999 , vol. 35, # 6 p. 913 - 915 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-Acetyl-5-bromoacenaphthene |
| 1-(5-Brom-acenaphthen-3-yl)-aethanon |
| 3-Acetyl-5-bromacenaphthen |
| 1-(5-bromo-acenaphthen-3-yl)-ethanone |