Rimantadine-d4 hydrochloride structure
|
Common Name | Rimantadine-d4 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 350818-67-6 | Molecular Weight | 219.78700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18ClD4N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Rimantadine-d4 hydrochlorideRimantadine-d4 hydrochloride is the deuterium labeled Rimantadine hydrochloride. Rimantadine hydrochloride is an anti-influenza virus agent[1][2]. |
| Name | rimantadine-d4 hcl (ethyl-d4) |
|---|---|
| Synonym | More Synonyms |
| Description | Rimantadine-d4 hydrochloride is the deuterium labeled Rimantadine hydrochloride. Rimantadine hydrochloride is an anti-influenza virus agent[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C12H18ClD4N |
|---|---|
| Molecular Weight | 219.78700 |
| Exact Mass | 219.16900 |
| PSA | 26.02000 |
| LogP | 4.05230 |
| InChIKey | OZBDFBJXRJWNAV-VQQQFJCBSA-N |
| SMILES | CC(N)C12CC3CC(CC(C3)C1)C2.Cl |
| RiMantadine-d4 HCl |
| 1-ADAMANTYLETHYLAMINE HCl |