4-acetamido-2-methylacetophenone structure
|
Common Name | 4-acetamido-2-methylacetophenone | ||
|---|---|---|---|---|
| CAS Number | 34956-31-5 | Molecular Weight | 191.22600 | |
| Density | 1.122g/cm3 | Boiling Point | 384.5ºC at 760mmHg | |
| Molecular Formula | C11H13NO2 | Melting Point | 137-140 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 167℃ | |
| Name | N-(4-acetyl-3-methylphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.122g/cm3 |
|---|---|
| Boiling Point | 384.5ºC at 760mmHg |
| Melting Point | 137-140 °C(lit.) |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.22600 |
| Flash Point | 167℃ |
| Exact Mass | 191.09500 |
| PSA | 46.17000 |
| LogP | 2.22900 |
| Index of Refraction | 1.563 |
| InChIKey | PTARWPNYVATTDE-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(C)=O)c(C)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Estrogenic Biphenyls. IV. 3'-Alkyl-4-methoxybiphenyl-4'-carboxylic Acids. Sato T and Oki M.
Bull. Chem. Soc. Jpn. 30(9) , 958-961, (1957)
|
| 2-Methyl-4-acetylamino-acetophenon |
| N-(4-Acetyl-3-methylphenyl)acetamide |
| 4′-Acetamido-2′-methylacetophenone |
| MFCD02258876 |
| 4-Acetamino-2-methyl-acetophenon |
| acetic acid-(4-acetyl-3-methyl-anilide) |
| 4'-Acetamido-2'-methylacetophenone |
| Essigsaeure-(4-acetyl-3-methyl-anilid) |