JX-401
Modify Date: 2025-08-25 12:14:31
JX-401 structure
|
Common Name | JX-401 | ||
|---|---|---|---|---|
| CAS Number | 349087-34-9 | Molecular Weight | 355.49400 | |
| Density | 1.17g/cm3 | Boiling Point | 537.3ºC at 760 mmHg | |
| Molecular Formula | C21H25NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.8ºC | |
Use of JX-401JX401 is a potent inhibitor of p38alpha, containing a 4-benzylpiperidine motif. p38alpha is hyperactive in inflammatory diseases, and various indications suggest that its inhibition would reverse inflammation. JX401 has the potential for the research of inflammation[1]. |
| Name | (4-benzylpiperidin-1-yl)-(2-methoxy-4-methylsulfanylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Description | JX401 is a potent inhibitor of p38alpha, containing a 4-benzylpiperidine motif. p38alpha is hyperactive in inflammatory diseases, and various indications suggest that its inhibition would reverse inflammation. JX401 has the potential for the research of inflammation[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 537.3ºC at 760 mmHg |
| Molecular Formula | C21H25NO2S |
| Molecular Weight | 355.49400 |
| Flash Point | 278.8ºC |
| Exact Mass | 355.16100 |
| PSA | 54.84000 |
| LogP | 4.44990 |
| Index of Refraction | 1.611 |
| InChIKey | OMGLGPKQUFSRNN-UHFFFAOYSA-N |
| SMILES | COc1cc(SC)ccc1C(=O)N1CCC(Cc2ccccc2)CC1 |
| 1-[2-Methoxy-4-(methylthio)benzoyl]-4-benzylpiperidine |
| JX401 |