5-BROMO-2.2.5-TRIMETHYL-1.3-DIOXANE-4.6-DIONE
Modify Date: 2025-08-20 17:56:47
5-BROMO-2.2.5-TRIMETHYL-1.3-DIOXANE-4.6-DIONE structure
|
Common Name | 5-BROMO-2.2.5-TRIMETHYL-1.3-DIOXANE-4.6-DIONE | ||
|---|---|---|---|---|
| CAS Number | 34817-42-0 | Molecular Weight | 237.04800 | |
| Density | 1.552g/cm3 | Boiling Point | 364.6ºC at 760mmHg | |
| Molecular Formula | C7H9BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.3ºC | |
| Name | 5-Bromo-2,2,5-trimethyl-1,3-dioxane-4,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.552g/cm3 |
|---|---|
| Boiling Point | 364.6ºC at 760mmHg |
| Molecular Formula | C7H9BrO4 |
| Molecular Weight | 237.04800 |
| Flash Point | 174.3ºC |
| Exact Mass | 235.96800 |
| PSA | 52.60000 |
| LogP | 0.97610 |
| Index of Refraction | 1.483 |
| InChIKey | XCOQDRFRYIKEMS-UHFFFAOYSA-N |
| SMILES | CC1(C)OC(=O)C(C)(Br)C(=O)O1 |
|
~%
5-BROMO-2.2.5-T... CAS#:34817-42-0 |
| Literature: JOHNS HOPKINS UNIVERSITY; GUTHRIE, Daryl A. Patent: WO2013/59194 A1, 2013 ; Location in patent: Page/Page column 38; 39 ; |
|
~%
5-BROMO-2.2.5-T... CAS#:34817-42-0 |
| Literature: Guthrie, Daryl A.; Kim, Nam Y.; Siegler, Maxime A.; Moore, Cathy D.; Toscano, John P. Journal of the American Chemical Society, 2012 , vol. 134, # 4 p. 1962 - 1965 |
| 5-bromo-5-methyl-Meldrum's acid |
| 5-bromo-2,2,5-trimethyl-[1,3]dioxane-4,6-dione |
| 5-brom-2,2,5-trimethyl-1,3-dioxan-4,6-dione |
| methyl bromo Meldrum's acid |
| EINECS 252-227-1 |
| Cyclo-isopropyliden-2-bromo-2-methylmalonat |