2,3,4,5,6-Pentafluoro-L-phenylalanine structure
|
Common Name | 2,3,4,5,6-Pentafluoro-L-phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 34702-59-5 | Molecular Weight | 255.141 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 286.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H6F5NO2 | Melting Point | 254-257℃ | |
| MSDS | N/A | Flash Point | 126.9±27.3 °C | |
| Name | (2S)-2-amino-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 286.3±40.0 °C at 760 mmHg |
| Melting Point | 254-257℃ |
| Molecular Formula | C9H6F5NO2 |
| Molecular Weight | 255.141 |
| Flash Point | 126.9±27.3 °C |
| Exact Mass | 255.031876 |
| PSA | 40.54000 |
| LogP | 1.30 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.486 |
| InChIKey | YYTDJPUFAVPHQA-VKHMYHEASA-N |
| SMILES | NC(Cc1c(F)c(F)c(F)c(F)c1F)C(=O)O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2922499990 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| L-3-(Pentafluorophenyl)alanine |
| (S)-2-Amino-3-(perfluorophenyl)propanoic acid |
| L-PENTAFLUOROPHE |
| (S)-2-Amino-3-(pentafluorophenyl)propanoic acid |
| Pentafluoro-L-phenylalanine |
| (2S)-2-Amino-3-(pentafluorophenyl)propanoic acid |
| L-Pentafluorophenylalanine |
| 2,3,4,5,6-Pentafluoro-L-phenylalanine |
| L-Phenylalanine, 2,3,4,5,6-pentafluoro- |
| MFCD01860881 |
| L-2,3,4,5,6-Pentafluorophenylalanine |
| H-Phe(F)5-OH |