Boc-L-pentafluorophenylalanine structure
|
Common Name | Boc-L-pentafluorophenylalanine | ||
|---|---|---|---|---|
| CAS Number | 34702-60-8 | Molecular Weight | 355.257 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 411.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H14F5NO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 202.4±28.7 °C | |
| Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 411.1±45.0 °C at 760 mmHg |
| Molecular Formula | C14H14F5NO4 |
| Molecular Weight | 355.257 |
| Flash Point | 202.4±28.7 °C |
| Exact Mass | 355.084290 |
| PSA | 75.63000 |
| LogP | 3.15 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.476 |
| InChIKey | UZDKQMIDSLETST-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1c(F)c(F)c(F)c(F)c1F)C(=O)O |
| Storage condition | -15°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| BOC-PENTAFLUORO-L-PHE-OH |
| BOC-L-PENTAFLUOROPHE |
| L-Pentafluorophenylalanine,N-BOC protected |
| N-(tert-Butoxycarbonyl)-2,3,4,5,6-pentafluoro-L-phenylalanine |
| Boc-L-Pentafluorophenylalanine |
| (S)-2-(Boc-amino)-3-(pentafluorophenyl)propionic acid |
| (2S)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-(pentafluorophenyl)propanoic acid |
| L-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-2,3,4,5,6-pentafluoro- |
| 2,3,4,5,6-Pentafluoro-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalanine |
| Boc-D-phe(F5)-OH |
| Boc-L-2,3,4,5,6-Pentafluorophenylalanine |
| BOC-PENTAFLUORO-PHE-OH |
| MFCD00151893 |
| Boc-Phe(F)5-OH |
| Boc-Phe(F5)-OH |