4-bromo-2-chloropyrimidine structure
|
Common Name | 4-bromo-2-chloropyrimidine | ||
|---|---|---|---|---|
| CAS Number | 3460-23-9 | Molecular Weight | 248.504 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 367.8±32.0 °C at 760 mmHg | |
| Molecular Formula | C8H7BrClNO | Melting Point | 151-152ºC | |
| MSDS | USA | Flash Point | 176.2±25.1 °C | |
| Name | N-(4-bromo-2-chlorophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 367.8±32.0 °C at 760 mmHg |
| Melting Point | 151-152ºC |
| Molecular Formula | C8H7BrClNO |
| Molecular Weight | 248.504 |
| Flash Point | 176.2±25.1 °C |
| Exact Mass | 246.939941 |
| PSA | 29.10000 |
| LogP | 2.44 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.623 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37 |
| HS Code | 2924299090 |
| Precursor 8 | |
|---|---|
| DownStream 5 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acetamide, N-(4-bromo-2-chlorophenyl)- |
| N-(4-Bromo-2-chlorophenyl)acetamide |
| 4-Bromo-2-Chloroacetanilide |
| 2-Chlor-4-brom-acetanilid |
| N1-(4-bromo-2-chlorophenyl)acetamide |
| 4'-Bromo-2'-chloroacetanilide |
| MFCD00040852 |
| 4-bromo-2-chloropyrimidine |