4,4'-Dichloro benzil structure
|
Common Name | 4,4'-Dichloro benzil | ||
|---|---|---|---|---|
| CAS Number | 3457-46-3 | Molecular Weight | 279.118 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 427.3±30.0 °C at 760 mmHg | |
| Molecular Formula | C14H8Cl2O2 | Melting Point | 194-197ºC | |
| MSDS | N/A | Flash Point | 180.4±25.1 °C | |
| Name | 4,4'-Dichlorobenzil |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 427.3±30.0 °C at 760 mmHg |
| Melting Point | 194-197ºC |
| Molecular Formula | C14H8Cl2O2 |
| Molecular Weight | 279.118 |
| Flash Point | 180.4±25.1 °C |
| Exact Mass | 277.990143 |
| PSA | 34.14000 |
| LogP | 4.91 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | XMAWUPHYEABFDR-UHFFFAOYSA-N |
| SMILES | O=C(C(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| MFCD00018685 |
| 1,2-bis(p-chlorophenyl)ethanedione |
| 4,4'-Dichlorobibenzoyl |
| 4,4'-dichlorobenzil |
| Bis(p-chlorophenyl)ethanedione |
| 4,4'-Dichlorodibenzoyl |
| 1,2-bis(4-chlorophenyl)ethanedione |
| Bis(4-chlorophenyl) diketone |
| 1,2-Ethanedione, 1,2-bis(4-chlorophenyl)- |
| p,p'-Dichlorobenzil |
| Ethanedione, bis(4-chlorophenyl)- |
| Benzil, 4,4'-dichloro- |
| 1,2-di(4-chlorophenyl)-1,2-ethanedione |
| bis(4-chlorophenyl)ethanedione |
| 1,2-Bis(4-chlorophenyl)ethane-1,2-dione |
| 1,2-Bis(4-chlorophenyl)-1,2-ethanedione |
| 1,2-BIS-(4-CHLORO-PHENYL)-ETHANE-1,2-DIONE |
| EINECS 222-387-7 |
| Di(4-chlorophenyl) diketone |
| 4,4'-Dichloro benzil |
| 1,2-bis(4-chlorophenyl)ethanediol |