Pelargonidin 3-galactoside chloride structure
|
Common Name | Pelargonidin 3-galactoside chloride | ||
|---|---|---|---|---|
| CAS Number | 34425-22-4 | Molecular Weight | 468.83800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21ClO10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Pelargonidin 3-galactoside chloridePelargonidin 3-galactoside chloride is a major anthocyanin with anticancer effects. Pelargonidin 3-galactoside chloride inhibits α-glucosidase[1]. |
| Name | (2R,3R,5S)-2-[5,7-dihydroxy-2-(4-hydroxyphenyl)chromenylium-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol,chloride |
|---|---|
| Synonym | More Synonyms |
| Description | Pelargonidin 3-galactoside chloride is a major anthocyanin with anticancer effects. Pelargonidin 3-galactoside chloride inhibits α-glucosidase[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Pelargonidin 3-galactoside chloride has antiproliferative activity on human colon cancer cells (HT29)[1]. |
| References |
| Molecular Formula | C21H21ClO10 |
|---|---|
| Molecular Weight | 468.83800 |
| Exact Mass | 468.08200 |
| PSA | 176.04000 |
| LogP | 1.91660 |
| InChIKey | CAHGSEFWVUVGGL-QSLGVYCOSA-N |
| SMILES | OCC1OC(Oc2cc3c(O)cc(O)cc3[o+]c2-c2ccc(O)cc2)C(O)C(O)C1O.[Cl-] |
| Hazard Codes | Xi |
|---|
| Pelargonidin 3-|A-D-Galactoside |
| Pelargonidin 3-Galactoside |