Peonidin-3-O-galactoside chloride structure
|
Common Name | Peonidin-3-O-galactoside chloride | ||
|---|---|---|---|---|
| CAS Number | 28148-89-2 | Molecular Weight | 498.864 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H23ClO11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Peonidin-3-O-galactoside chloridePeonidin-3-O-galactoside chloride is an anthocyanin with antioxidant properties[1]. |
| Name | 595285F29O |
|---|---|
| Synonym | More Synonyms |
| Description | Peonidin-3-O-galactoside chloride is an anthocyanin with antioxidant properties[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C22H23ClO11 |
|---|---|
| Molecular Weight | 498.864 |
| Exact Mass | 498.092896 |
| InChIKey | VDTNZDSOEFSAIZ-HVOKISQTSA-N |
| SMILES | COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2OC2OC(CO)C(O)C(O)C2O)ccc1O.[Cl-] |
| Hazard Codes | Xi |
|---|
| 595285F29O |
| PEONIDIN 3-GALACTOSIDE |
| 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-chromeniumyl β-D-galactopyranoside chloride |
| β-D-Galactopyranoside, 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-1-benzopyrylium-3-yl, chloride (1:1) |