ethyl 2-methyl-4,4,4-trifluoroacetoacetate structure
|
Common Name | ethyl 2-methyl-4,4,4-trifluoroacetoacetate | ||
|---|---|---|---|---|
| CAS Number | 344-00-3 | Molecular Weight | 198.14000 | |
| Density | 1,2 g/cm3 | Boiling Point | 144 °C | |
| Molecular Formula | C7H9F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 47°C | |
| Name | ethyl 4,4,4-trifluoro-2-methyl-3-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1,2 g/cm3 |
|---|---|
| Boiling Point | 144 °C |
| Molecular Formula | C7H9F3O3 |
| Molecular Weight | 198.14000 |
| Flash Point | 47°C |
| Exact Mass | 198.05000 |
| PSA | 43.37000 |
| LogP | 1.31700 |
| Index of Refraction | 1.374 |
| InChIKey | YLRGPBKEZVHOAW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)C(=O)C(F)(F)F |
| Hazard Codes | F: Flammable;Xi: Irritant; |
|---|---|
| Risk Phrases | R10;R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | 3272 |
| Packaging Group | III |
| Hazard Class | 3 |
| HS Code | 2918300090 |
|
~50%
ethyl 2-methyl-... CAS#:344-00-3 |
| Literature: Aubert, Corinne; Begue, Jean-Pierre; Charpentier-Morize, Micheline; Nee, Gerard; Langlois, Bernard Journal of Fluorine Chemistry, 1989 , vol. 44, p. 361 - 376 |
|
~%
ethyl 2-methyl-... CAS#:344-00-3 |
| Literature: Journal of the American Chemical Society, , vol. 78, p. 4053,4056 |
|
~%
ethyl 2-methyl-... CAS#:344-00-3 |
| Literature: Tetrahedron, , vol. 20, p. 2162 - 2166 |
|
~%
ethyl 2-methyl-... CAS#:344-00-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 23, # 12 p. 3505 - 3510 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl 2-methyl-4,4,4-trifluoroacetoacetate |
| ethyl 2-methyltrifluoroacetoacetate |
| 4,4,4-trifluoro-2-methyl-3-oxo-butyric acid ethyl ester |
| MFCD00190635 |
| Ethyl 4,4,4-trifluoro-2-methyl-3-oxobutanoate |
| ethyl-3-keto-2-methyl-4,4,4-trifluorobutanoate |
| ZLB0114 |
| ethyl 3-keto-2-methyl-4,4,4-trifluorobutyrate |