ent-Kaurane-2α,16β-diol structure
|
Common Name | ent-Kaurane-2α,16β-diol | ||
|---|---|---|---|---|
| CAS Number | 34302-37-9 | Molecular Weight | 306.483 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 416.9±28.0 °C at 760 mmHg | |
| Molecular Formula | C20H34O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.8±18.6 °C | |
Use of ent-Kaurane-2α,16β-diol2,16-Kauranediol, a diterpene compound, is a natural product that can be isolated from the aerial part of Euphorbia hirta[1]. |
| Name | 2,16-Kauranediol |
|---|---|
| Synonym | More Synonyms |
| Description | 2,16-Kauranediol, a diterpene compound, is a natural product that can be isolated from the aerial part of Euphorbia hirta[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 416.9±28.0 °C at 760 mmHg |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.483 |
| Flash Point | 183.8±18.6 °C |
| Exact Mass | 306.255890 |
| PSA | 40.46000 |
| LogP | 4.83 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | YVJJGMPQYRNACB-CGZHXTAKSA-N |
| SMILES | CC1(C)CC(O)CC2(C)C1CCC13CC(CCC12)C(C)(O)C3 |
| Hazard Codes | Xi |
|---|
| (2β,5β,8α,9β,10α,13α,16β)-Kaurane-2,16-diol |