1,1,1,3,3,4,4,4-octafluorobutan-2-one structure
|
Common Name | 1,1,1,3,3,4,4,4-octafluorobutan-2-one | ||
|---|---|---|---|---|
| CAS Number | 337-20-2 | Molecular Weight | 216.02900 | |
| Density | 1.595g/cm3 | Boiling Point | 0ºC | |
| Molecular Formula | C4F8O | Melting Point | -126ºC(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1,3,3,4,4,4-octafluorobutan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.595g/cm3 |
|---|---|
| Boiling Point | 0ºC |
| Melting Point | -126ºC(lit.) |
| Molecular Formula | C4F8O |
| Molecular Weight | 216.02900 |
| Exact Mass | 215.98200 |
| PSA | 17.07000 |
| LogP | 2.31540 |
| Index of Refraction | 1.255 |
| InChIKey | QJPLLYVRTUXAHZ-UHFFFAOYSA-N |
| SMILES | O=C(C(F)(F)F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | UN 1956 2.2 |
| Hazard Class | 2.3 |
| HS Code | 2914700090 |
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Perfluoro-2-butanone |
| MFCD00216737 |
| octafluorobutan-2-one |
| perfluorobutan-2-one |
| F-2-butanone |
| Octafluoro-2-butanone |
| perfluorobutanone |
| 1,1,1,3,3,4,4,4-octafluoro-butan-2-one |