4',4,4''-TRIMETHYL-2,2':6',2''-TERPYRIDINE
Modify Date: 2025-08-26 23:05:29
4',4,4''-TRIMETHYL-2,2':6',2''-TERPYRIDINE structure
|
Common Name | 4',4,4''-TRIMETHYL-2,2':6',2''-TERPYRIDINE | ||
|---|---|---|---|---|
| CAS Number | 33354-75-5 | Molecular Weight | 275.34800 | |
| Density | 1.108g/cm3 | Boiling Point | 422.5ºC at 760mmHg | |
| Molecular Formula | C18H17N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.9ºC | |
| Name | 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.108g/cm3 |
|---|---|
| Boiling Point | 422.5ºC at 760mmHg |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.34800 |
| Flash Point | 183.9ºC |
| Exact Mass | 275.14200 |
| PSA | 38.67000 |
| LogP | 4.13080 |
| Index of Refraction | 1.592 |
| InChIKey | VEOPFEPGENIUIA-UHFFFAOYSA-N |
| SMILES | Cc1ccnc(-c2cc(C)cc(-c3cc(C)ccn3)n2)c1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933399090 |
|
~55%
4',4,4''-TRIMET... CAS#:33354-75-5 |
| Literature: Fallahpour Synthesis, 2000 , # 12 p. 1665 - 1667 |
|
~%
4',4,4''-TRIMET... CAS#:33354-75-5 |
| Literature: Fallahpour Synthesis, 2000 , # 12 p. 1665 - 1667 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,4',4''-trimethyl-[2,2',6',2'']terpyridine |
| 2,2':6',2''-Ter-4-picoline |
| 2,2':6',2''-Terpyridine,4,4',4''-trimethyl |