4',4,4''-TRIMETHYL-2,2':6',2''-TERPYRIDINE
4',4,4''-TRIMETHYL-2,2':6',2''-TERPYRIDINE structure
|
Common Name | 4',4,4''-TRIMETHYL-2,2':6',2''-TERPYRIDINE | ||
|---|---|---|---|---|
| CAS Number | 33354-75-5 | Molecular Weight | 275.34800 | |
| Density | 1.108g/cm3 | Boiling Point | 422.5ºC at 760mmHg | |
| Molecular Formula | C18H17N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.108g/cm3 |
|---|---|
| Boiling Point | 422.5ºC at 760mmHg |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.34800 |
| Flash Point | 183.9ºC |
| Exact Mass | 275.14200 |
| PSA | 38.67000 |
| LogP | 4.13080 |
| Index of Refraction | 1.592 |
| InChIKey | VEOPFEPGENIUIA-UHFFFAOYSA-N |
| SMILES | Cc1ccnc(-c2cc(C)cc(-c3cc(C)ccn3)n2)c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933399090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~55%
4',4,4''-TRIMET... CAS#:33354-75-5 |
| Literature: Fallahpour Synthesis, 2000 , # 12 p. 1665 - 1667 |
|
~%
4',4,4''-TRIMET... CAS#:33354-75-5 |
| Literature: Fallahpour Synthesis, 2000 , # 12 p. 1665 - 1667 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,4',4''-trimethyl-[2,2',6',2'']terpyridine |
| 2,2':6',2''-Ter-4-picoline |
| 2,2':6',2''-Terpyridine,4,4',4''-trimethyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine? |
| A: LogP of 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine is 4.13080. |
| Q: What is the SMILES notation of 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine? |
| A: SMILES notation of 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine is Cc1ccnc(-c2cc(C)cc(-c3cc(C)ccn3)n2)c1. |
| Q: What English synonyms does 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine have? |
| A: English synonyms of 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine: 4,4',4''-trimethyl-[2,2',6',2'']terpyridine, 2,2':6',2''-Ter-4-picoline, 2,2':6',2''-Terpyridine,4,4',4''-trimethyl. |
| Q: What is the boiling point of 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine? |
| A: Boiling point of 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine is 422.5ºC at 760mmHg. |
| Q: What is the InChIKey of 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine? |
| A: InChIKey of 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine is VEOPFEPGENIUIA-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine? |
| A: Molecular weight of 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine is 275.34800. |
| Q: What is the CAS number of 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine? |
| A: CAS number of 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine is 33354-75-5. |
| Q: What is the molecular formula of 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine? |
| A: Molecular formula of 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine is C18H17N3. |
| Q: What is the polar surface area (PSA) of 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine? |
| A: Polar surface area (PSA) of 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine is 38.67000. |
| Q: What is the English name of 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine? |
| A: The English name of 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine is 4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |