glucosyringic acid
Modify Date: 2025-08-24 17:52:02
glucosyringic acid structure
|
Common Name | glucosyringic acid | ||
|---|---|---|---|---|
| CAS Number | 33228-65-8 | Molecular Weight | 360.313 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 611.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C15H20O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.7±25.0 °C | |
Use of glucosyringic acidGlucosyringic acid is a compound isolated from Saxifraga Montana H.[1]. |
| Name | 3,5-dimethoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Glucosyringic acid is a compound isolated from Saxifraga Montana H.[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Jun-Xi Liu, et al. Diversity of Chemical Constituents from Saxifraga Montana H. |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 611.1±55.0 °C at 760 mmHg |
| Molecular Formula | C15H20O10 |
| Molecular Weight | 360.313 |
| Flash Point | 224.7±25.0 °C |
| Exact Mass | 360.105652 |
| PSA | 155.14000 |
| LogP | -1.19 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | BLKMDORKRDACEI-OVKLUEDNSA-N |
| SMILES | COc1cc(C(=O)O)cc(OC)c1OC1OC(CO)C(O)C(O)C1O |
| Hazard Codes | Xi |
|---|
|
~75%
glucosyringic acid CAS#:33228-65-8 |
| Literature: Delay, Didier; Delmotte, Francis Carbohydrate Research, 1990 , vol. 198, # 2 p. 223 - 234 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| glucosyringic acid |
| Benzoic acid, 4-(β-D-glucopyranosyloxy)-3,5-dimethoxy- |
| 4-(β-D-Glucopyranosyloxy)-3,5-dimethoxybenzoic acid |