AGX51
Modify Date: 2025-11-30 19:32:31
AGX51 structure
|
Common Name | AGX51 | ||
|---|---|---|---|---|
| CAS Number | 330834-54-3 | Molecular Weight | 431.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H29NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of AGX51AGX51 is a first-in-class pan-Id (inhibitors of DNA-binding/differentiation proteins) antagonist and degrader. AGX51 inhibits the Id1-E47 interaction, leading to ubiquitin-mediated degradation of Ids, cell growth arrest, and reduces viability. AGX51 inhibits pathologic ocular neovascularization[1]. |
| Name | AGX51 |
|---|
| Description | AGX51 is a first-in-class pan-Id (inhibitors of DNA-binding/differentiation proteins) antagonist and degrader. AGX51 inhibits the Id1-E47 interaction, leading to ubiquitin-mediated degradation of Ids, cell growth arrest, and reduces viability. AGX51 inhibits pathologic ocular neovascularization[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C27H29NO4 |
|---|---|
| Molecular Weight | 431.52 |
| InChIKey | SRADCMOCDMFMPS-UHFFFAOYSA-N |
| SMILES | CCC(=O)N(CCC(c1ccc2c(c1)OCO2)c1ccccc1OC)Cc1ccccc1 |
| Hazard Codes | Xi |
|---|