DMTr-TNA-U-amidite
Modify Date: 2025-09-18 17:55:21
DMTr-TNA-U-amidite structure
|
Common Name | DMTr-TNA-U-amidite | ||
|---|---|---|---|---|
| CAS Number | 325683-95-2 | Molecular Weight | 716.76 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H45N4O8P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DMTr-TNA-U-amiditeDMTr-TNA-U-amidite is a phosphorite monomer that can be used in the synthesis of oligonucleotides. |
| Name | DMTr-TNA-U-amidite |
|---|
| Description | DMTr-TNA-U-amidite is a phosphorite monomer that can be used in the synthesis of oligonucleotides. |
|---|---|
| Related Catalog |
| Molecular Formula | C38H45N4O8P |
|---|---|
| Molecular Weight | 716.76 |
| InChIKey | CTMYNQLRHZTTLF-YPQZKSMWSA-N |
| SMILES | COc1ccc(C(OC2COC(n3ccc(=O)[nH]c3=O)C2OP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |