2,7-Dinitro-9H-fluoren-9-one structure
|
Common Name | 2,7-Dinitro-9H-fluoren-9-one | ||
|---|---|---|---|---|
| CAS Number | 31551-45-8 | Molecular Weight | 270.197 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 504.2±43.0 °C at 760 mmHg | |
| Molecular Formula | C13H6N2O5 | Melting Point | 292-295 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 263.5±21.0 °C | |
| Name | 2,7-dinitrofluoren-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 504.2±43.0 °C at 760 mmHg |
| Melting Point | 292-295 °C(lit.) |
| Molecular Formula | C13H6N2O5 |
| Molecular Weight | 270.197 |
| Flash Point | 263.5±21.0 °C |
| Exact Mass | 270.027679 |
| PSA | 108.71000 |
| LogP | 3.24 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.727 |
| InChIKey | HDVGAFBXTXDYIB-UHFFFAOYSA-N |
| SMILES | O=C1c2cc([N+](=O)[O-])ccc2-c2ccc([N+](=O)[O-])cc21 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Precursor 7 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
Spontaneous and mutagen-induced deletions: mechanistic studies in Salmonella tester strain TA102.
Proc. Natl. Acad. Sci. U. S. A. 81(14) , 4457-61, (1984) Salmonella tester strain TA102 carries the hisG428 ochre mutation on the multicopy plasmid pAQ1. DNA sequence analysis of 45 spontaneous revertants of hisG428 on the chromosome in the presence of pKM1... |
|
|
Mutagenicity of diesel-exhaust particle extract, 1-nitropyrene, and 2,7-dinitrofluorenone in Salmonella typhimurium under various metabolic activation conditions.
Mutat. Res. 124(3-4) , 191-200, (1983) The mutagenic activities of 1-nitropyrene (1-NP), 2,7-dinitrofluorenone (2,7-DNF), and a diesel-exhaust extract were compared using the Salmonella typhimurium plate-incorporation assay. Each sample wa... |
|
|
Charge transfer complexes of 9-vinyl-carbazole with pi acceptors in homogeneous and in micellar solutions.
Spectrochim. Acta. A. Mol. Biomol. Spectrosc. 60(7) , 1421-6, (2004) The molecular association of 9-vinyl-carbazole (CBZ) with three electron acceptors, p-chloranil (CHL), 2,7-dinitro-9-fluorenone (FL), and tetracyano-p-quinodimethane (TCNQ), is studied in acetonitrile... |
| 9-Oxo-2,7-dinitrofluorene |
| 2,7-dinitrofluorenone |
| 2,7-Dinitro-fluoren-9-on |
| 9H-Fluoren-9-one, 2,7-dinitro- |
| 2,7-Dinitro-9H-fluoren-9-one |
| 2,5-DIMETHYLPHENYL ISOTHIOCYANATE |
| 2,7-dinitro-fluoren-9-one |
| Fluoren-9-one,2,7-dinitro |
| 2,7-Dinitro-9-fluorenone |
| 9-Fluorenone,2,7-dinitro |
| 9H-Fluoren-9-one,2,7-dinitro |
| EINECS 250-695-1 |
| MFCD00001153 |