9H-Fluoren-9-one,2,7-dinitro-, oxime
Modify Date: 2025-09-27 21:10:13
9H-Fluoren-9-one,2,7-dinitro-, oxime structure
|
Common Name | 9H-Fluoren-9-one,2,7-dinitro-, oxime | ||
|---|---|---|---|---|
| CAS Number | 23818-25-9 | Molecular Weight | 285.21200 | |
| Density | 1.68g/cm3 | Boiling Point | 548.8ºC at 760mmHg | |
| Molecular Formula | C13H7N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.7ºC | |
| Name | N-(2,7-dinitrofluoren-9-ylidene)hydroxylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.68g/cm3 |
|---|---|
| Boiling Point | 548.8ºC at 760mmHg |
| Molecular Formula | C13H7N3O5 |
| Molecular Weight | 285.21200 |
| Flash Point | 285.7ºC |
| Exact Mass | 285.03900 |
| PSA | 124.23000 |
| LogP | 3.75640 |
| Vapour Pressure | 7.05E-13mmHg at 25°C |
| Index of Refraction | 1.766 |
| InChIKey | ASHANQNSFRKUPX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C(=NO)c1cc([N+](=O)[O-])ccc1-2 |
| HS Code | 2928000090 |
|---|
|
~%
9H-Fluoren-9-on... CAS#:23818-25-9 |
| Literature: Schmidt,J.; Bauer Chemische Berichte, 1905 , vol. 38, p. 3760 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2,7-Dinitro-fluoren-9-on-oxim |
| 2,7-dinitro-fluoren-9-one oxime |
| 2,7-dinitro-9h-fluoren-9-one oxime |