2-thienyl-n n-bis(2-thienylmethylene)me& structure
|
Common Name | 2-thienyl-n n-bis(2-thienylmethylene)me& | ||
|---|---|---|---|---|
| CAS Number | 314280-18-7 | Molecular Weight | 316.46400 | |
| Density | 1.31g/cm3 | Boiling Point | 443.242ºC at 760 mmHg | |
| Molecular Formula | C15H12N2S3 | Melting Point | 111-115ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 221.865ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-thienyl-n n-bis(2-thienylmethylene)me& |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 443.242ºC at 760 mmHg |
| Melting Point | 111-115ºC(lit.) |
| Molecular Formula | C15H12N2S3 |
| Molecular Weight | 316.46400 |
| Flash Point | 221.865ºC |
| Exact Mass | 316.01600 |
| PSA | 109.44000 |
| LogP | 5.10790 |
| Index of Refraction | 1.702 |
| InChIKey | JFBOACJJWSHXAS-OTYYAQKOSA-N |
| SMILES | C(=NC(N=Cc1cccs1)c1cccs1)c1cccs1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |