| Name | 2-chloro-N,N-bis(2-chloroethyl)phenothiazine-10-carboxamide |
|---|---|
| Synonyms |
2-chloro-phenothiazine-10-carboxylic acid bis-(2-chloro-ethyl)-amide
N,N-Bis(2-chloroethyl)-2-chloro-10H-phenothiazine-10-carboxamide 10H-Phenothiazine-10-carboxamide,N,N-bis(2-chloroethyl)-2-chloro |
| Density | 1.438g/cm3 |
|---|---|
| Boiling Point | 527.5ºC at 760 mmHg |
| Molecular Formula | C17H15Cl3N2OS |
| Molecular Weight | 401.73800 |
| Flash Point | 272.8ºC |
| Exact Mass | 399.99700 |
| PSA | 48.85000 |
| LogP | 5.90730 |
| Index of Refraction | 1.653 |
|
~%
65240-97-3 |
| Literature: Lambrou; Tsatsas; Champagnac; Pommier European Journal of Medicinal Chemistry, 1977 , vol. 12, # 5 p. 488 - 488 |
|
~%
65240-97-3 |
| Literature: Lambrou; Tsatsas; Champagnac; Pommier European Journal of Medicinal Chemistry, 1977 , vol. 12, # 5 p. 488 - 488 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |